About sodium;5-methyl-1H-pyrazole;tetrafluoroborate
sodium;5-methyl-1H-pyrazole;tetrafluoroborate (PubChem CID 174896612) has the molecular formula C4H6BF4N2Na
and a molecular weight of 191.90 g/mol. Its IUPAC name is sodium;5-methyl-1H-pyrazole;tetrafluoroborate.
Molecular Properties
| Compound Name | sodium;5-methyl-1H-pyrazole;tetrafluoroborate |
| PubChem CID | 174896612 |
| Molecular Formula | C4H6BF4N2Na |
| Molecular Weight | 191.90 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | sodium;5-methyl-1H-pyrazole;tetrafluoroborate |
| SMILES | Cc1ccn[nH]1.F[B-](F)(F)F.[Na+] |
| InChI | InChI=1S/C4H6N2.BF4.Na/c1-4-2-3-5-6-4;2-1(3,4)5;/h2-3H,1H3,(H,5,6);;/q;-1;+1 |
| InChIKey | KKHXIURMYPJKGI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.90 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;5-methyl-1H-pyrazole;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;5-methyl-1H-pyrazole;tetrafluoroborate?
The IUPAC name of sodium;5-methyl-1H-pyrazole;tetrafluoroborate (CID 174896612) is sodium;5-methyl-1H-pyrazole;tetrafluoroborate.
What is the SMILES notation for sodium;5-methyl-1H-pyrazole;tetrafluoroborate?
The canonical SMILES for sodium;5-methyl-1H-pyrazole;tetrafluoroborate is Cc1ccn[nH]1.F[B-](F)(F)F.[Na+].
What is the InChIKey of sodium;5-methyl-1H-pyrazole;tetrafluoroborate?
The InChIKey is KKHXIURMYPJKGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2.BF4.Na/c1-4-2-3-5-6-4;2-1(3,4)5;/h2-3H,1H3,(H,5,6);;/q;-1;+1.
What are the key properties of sodium;5-methyl-1H-pyrazole;tetrafluoroborate?
sodium;5-methyl-1H-pyrazole;tetrafluoroborate has a molecular weight of 191.90 g/mol, XLogP of -0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;5-methyl-1H-pyrazole;tetrafluoroborate is sourced from PubChem (CID 174896612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).