About 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole
2-methylprop-2-enoic acid;5-methyl-1H-pyrazole (PubChem CID 175313871) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole |
| PubChem CID | 175313871 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole |
| SMILES | C=C(C)C(=O)O.Cc1ccn[nH]1 |
| InChI | InChI=1S/C4H6N2.C4H6O2/c1-4-2-3-5-6-4;1-3(2)4(5)6/h2-3H,1H3,(H,5,6);1H2,2H3,(H,5,6) |
| InChIKey | LMOHNPOZRHQUCK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole?
The IUPAC name of 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole (CID 175313871) is 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole.
What is the SMILES notation for 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole?
The canonical SMILES for 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole is C=C(C)C(=O)O.Cc1ccn[nH]1.
What is the InChIKey of 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole?
The InChIKey is LMOHNPOZRHQUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2.C4H6O2/c1-4-2-3-5-6-4;1-3(2)4(5)6/h2-3H,1H3,(H,5,6);1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole?
2-methylprop-2-enoic acid;5-methyl-1H-pyrazole has a molecular weight of 168.20 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;5-methyl-1H-pyrazole is sourced from PubChem (CID 175313871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).