About bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole
bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole (PubChem CID 144866527) has the molecular formula C12H20N2O
and a molecular weight of 208.31 g/mol. Its IUPAC name is bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole |
| PubChem CID | 144866527 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole |
| SMILES | CC.Cc1ccn[nH]1.O=C1CC2CC2C1 |
| InChI | InChI=1S/C6H8O.C4H6N2.C2H6/c7-6-2-4-1-5(4)3-6;1-4-2-3-5-6-4;1-2/h4-5H,1-3H2;2-3H,1H3,(H,5,6);1-2H3 |
| InChIKey | ANEHIGVRYSLCAV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole?
The IUPAC name of bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole (CID 144866527) is bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole.
What is the SMILES notation for bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole?
The canonical SMILES for bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole is CC.Cc1ccn[nH]1.O=C1CC2CC2C1.
What is the InChIKey of bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole?
The InChIKey is ANEHIGVRYSLCAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O.C4H6N2.C2H6/c7-6-2-4-1-5(4)3-6;1-4-2-3-5-6-4;1-2/h4-5H,1-3H2;2-3H,1H3,(H,5,6);1-2H3.
What are the key properties of bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole?
bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole has a molecular weight of 208.31 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexan-3-one;ethane;5-methyl-1H-pyrazole is sourced from PubChem (CID 144866527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).