About diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine
diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine (PubChem CID 174897290) has the molecular formula C20H33NO6S
and a molecular weight of 415.55 g/mol. Its IUPAC name is diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine.
Molecular Properties
| Compound Name | diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine |
| PubChem CID | 174897290 |
| Molecular Formula | C20H33NO6S |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine |
| SMILES | CCC(N)S(=O)(=O)c1ccccc1C.CCOC(=O)CCCCC(=O)OCC |
| InChI | InChI=1S/C10H15NO2S.C10H18O4/c1-3-10(11)14(12,13)9-7-5-4-6-8(9)2;1-3-13-9(11)7-5-6-8-10(12)14-4-2/h4-7,10H,3,11H2,1-2H3;3-8H2,1-2H3 |
| InChIKey | KFFFWWCCUSZGOZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine?
The IUPAC name of diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine (CID 174897290) is diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine.
What is the SMILES notation for diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine?
The canonical SMILES for diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine is CCC(N)S(=O)(=O)c1ccccc1C.CCOC(=O)CCCCC(=O)OCC.
What is the InChIKey of diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine?
The InChIKey is KFFFWWCCUSZGOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2S.C10H18O4/c1-3-10(11)14(12,13)9-7-5-4-6-8(9)2;1-3-13-9(11)7-5-6-8-10(12)14-4-2/h4-7,10H,3,11H2,1-2H3;3-8H2,1-2H3.
What are the key properties of diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine?
diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine has a molecular weight of 415.55 g/mol, XLogP of 3.14, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl hexanedioate;1-(2-methylphenyl)sulfonylpropan-1-amine is sourced from PubChem (CID 174897290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).