C7H8Cl3IO4 — CID 174897550
1-O-methyl 3-O-(1,2,2-trichloroethyl) 2-(iodomethyl)propanedioate (PubChem CID 174897550) has the molecular formula C7H8Cl3IO4 and a molecular weight of 389.40 g/mol. Its IUPAC name is 1-O-methyl 3-O-(1,2,2-trichloroethyl) 2-(iodomethyl)propanedioate.
| Compound Name | 1-O-methyl 3-O-(1,2,2-trichloroethyl) 2-(iodomethyl)propanedioate |
|---|---|
| PubChem CID | 174897550 |
| Molecular Formula | C7H8Cl3IO4 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 387.85 |
| IUPAC Name | 1-O-methyl 3-O-(1,2,2-trichloroethyl) 2-(iodomethyl)propanedioate |
| SMILES | COC(=O)C(CI)C(=O)OC(Cl)C(Cl)Cl |
| InChI | InChI=1S/C7H8Cl3IO4/c1-14-6(12)3(2-11)7(13)15-5(10)4(8)9/h3-5H,2H2,1H3 |
| InChIKey | HQLCJBOFSZXENY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|