C35H60S — CID 174899684
(4aR,6aR,6aR,6bR,8aR,11R,12S,12aS,14aR,14bR)-4,4,6a,6b,8a,11,12,14b-octamethyl-1-pent-4-enyl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picene-3-thiol (PubChem CID 174899684) has the molecular formula C35H60S and a molecular weight of 512.93 g/mol. Its IUPAC name is (4aR,6aR,6aR,6bR,8aR,11R,12S,12aS,14aR,14bR)-4,4,6a,6b,8a,11,12,14b-octamethyl-1-pent-4-enyl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picene-3-thiol.
| Compound Name | (4aR,6aR,6aR,6bR,8aR,11R,12S,12aS,14aR,14bR)-4,4,6a,6b,8a,11,12,14b-octamethyl-1-pent-4-enyl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picene-3-thiol |
|---|---|
| PubChem CID | 174899684 |
| Molecular Formula | C35H60S |
| Molecular Weight | 512.93 g/mol |
| Exact Mass | 512.44 |
| IUPAC Name | (4aR,6aR,6aR,6bR,8aR,11R,12S,12aS,14aR,14bR)-4,4,6a,6b,8a,11,12,14b-octamethyl-1-pent-4-enyl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picene-3-thiol |
| SMILES | C=CCCCC1CC(S)C(C)(C)[C@@H]2CC[C@]3(C)[C@H](CC[C@@H]4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C)CC[C@]43C)[C@@]12C |
| InChI | InChI=1S/C35H60S/c1-10-11-12-13-25-22-29(36)31(4,5)27-17-19-34(8)28(35(25,27)9)15-14-26-30-24(3)23(2)16-18-32(30,6)20-21-33(26,34)7/h10,23-30,36H,1,11-22H2,2-9H3/t23-,24+,25?,26-,27+,28+,29?,30+,32-,33-,34-,35+/m1/s1 |
| InChIKey | RYHFOXJDKSPQBT-RZHFRIGMSA-N |
| XLogP | 10.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.93 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|