C31H54S — CID 174910159
(4aR,6aR,6aR,6bR,8aR,11R,12S,12aS,14aS,14bR)-4,4,4a,6a,6b,8a,11,12,14b-nonamethyl-1,2,3,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydropicene-3-thiol (PubChem CID 174910159) has the molecular formula C31H54S and a molecular weight of 458.84 g/mol. Its IUPAC name is (4aR,6aR,6aR,6bR,8aR,11R,12S,12aS,14aS,14bR)-4,4,4a,6a,6b,8a,11,12,14b-nonamethyl-1,2,3,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydropicene-3-thiol.
| Compound Name | (4aR,6aR,6aR,6bR,8aR,11R,12S,12aS,14aS,14bR)-4,4,4a,6a,6b,8a,11,12,14b-nonamethyl-1,2,3,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydropicene-3-thiol |
|---|---|
| PubChem CID | 174910159 |
| Molecular Formula | C31H54S |
| Molecular Weight | 458.84 g/mol |
| Exact Mass | 458.39 |
| IUPAC Name | (4aR,6aR,6aR,6bR,8aR,11R,12S,12aS,14aS,14bR)-4,4,4a,6a,6b,8a,11,12,14b-nonamethyl-1,2,3,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydropicene-3-thiol |
| SMILES | C[C@@H]1[C@H]2[C@H]3CC[C@@H]4[C@@]5(C)CCC(S)C(C)(C)[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@]2(C)CC[C@H]1C |
| InChI | InChI=1S/C31H54S/c1-20-12-14-27(5)16-17-28(6)22(25(27)21(20)2)10-11-23-29(28,7)18-19-31(9)26(3,4)24(32)13-15-30(23,31)8/h20-25,32H,10-19H2,1-9H3/t20-,21+,22-,23+,24?,25+,27-,28-,29-,30-,31+/m1/s1 |
| InChIKey | QJZNJNSUDUAWKF-CDAXIDBNSA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.84 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|