C10H18ClN — CID 174900251
2,3-dimethyl-1-propyl-2H-pyridine;hydrochloride (PubChem CID 174900251) has the molecular formula C10H18ClN and a molecular weight of 187.71 g/mol. Its IUPAC name is 2,3-dimethyl-1-propyl-2H-pyridine;hydrochloride.
| Compound Name | 2,3-dimethyl-1-propyl-2H-pyridine;hydrochloride |
|---|---|
| PubChem CID | 174900251 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2,3-dimethyl-1-propyl-2H-pyridine;hydrochloride |
| SMILES | CCCN1C=CC=C(C)C1C.Cl |
| InChI | InChI=1S/C10H17N.ClH/c1-4-7-11-8-5-6-9(2)10(11)3;/h5-6,8,10H,4,7H2,1-3H3;1H |
| InChIKey | NJWRTCGOSIPEKQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |