About 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene
2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene (PubChem CID 174902232) has the molecular formula C22H28O2
and a molecular weight of 324.46 g/mol. Its IUPAC name is 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene.
Molecular Properties
| Compound Name | 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene |
| PubChem CID | 174902232 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene |
| SMILES | CC1(C)CCCC(C2CC2C(=O)O)C1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H20O2.C10H8/c1-12(2)5-3-4-8(7-12)9-6-10(9)11(13)14;1-2-6-10-8-4-3-7-9(10)5-1/h8-10H,3-7H2,1-2H3,(H,13,14);1-8H |
| InChIKey | QZGPUDLCRLMGSD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene?
The IUPAC name of 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene (CID 174902232) is 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene.
What is the SMILES notation for 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene?
The canonical SMILES for 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene is CC1(C)CCCC(C2CC2C(=O)O)C1.c1ccc2ccccc2c1.
What is the InChIKey of 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene?
The InChIKey is QZGPUDLCRLMGSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2.C10H8/c1-12(2)5-3-4-8(7-12)9-6-10(9)11(13)14;1-2-6-10-8-4-3-7-9(10)5-1/h8-10H,3-7H2,1-2H3,(H,13,14);1-8H.
What are the key properties of 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene?
2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene has a molecular weight of 324.46 g/mol, XLogP of 5.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylcyclohexyl)cyclopropane-1-carboxylic acid;naphthalene is sourced from PubChem (CID 174902232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).