C21H26N2O3 — CID 17490390
ethyl 2-[[2-[1-(2,5-dimethylphenyl)ethylamino]acetyl]amino]benzoate (PubChem CID 17490390) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is ethyl 2-[[2-[1-(2,5-dimethylphenyl)ethylamino]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[1-(2,5-dimethylphenyl)ethylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 17490390 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | ethyl 2-[[2-[1-(2,5-dimethylphenyl)ethylamino]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CNC(C)c1cc(C)ccc1C |
| InChI | InChI=1S/C21H26N2O3/c1-5-26-21(25)17-8-6-7-9-19(17)23-20(24)13-22-16(4)18-12-14(2)10-11-15(18)3/h6-12,16,22H,5,13H2,1-4H3,(H,23,24) |
| InChIKey | DJXXEASBIQVNGY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |