C17H25N3O5 — CID 139990554
(2S)-6-amino-2-[[2-(2-ethoxycarbonylanilino)-2-oxoethyl]amino]hexanoic acid (PubChem CID 139990554) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-(2-ethoxycarbonylanilino)-2-oxoethyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-(2-ethoxycarbonylanilino)-2-oxoethyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 139990554 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2S)-6-amino-2-[[2-(2-ethoxycarbonylanilino)-2-oxoethyl]amino]hexanoic acid |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CN[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C17H25N3O5/c1-2-25-17(24)12-7-3-4-8-13(12)20-15(21)11-19-14(16(22)23)9-5-6-10-18/h3-4,7-8,14,19H,2,5-6,9-11,18H2,1H3,(H,20,21)(H,22,23)/t14-/m0/s1 |
| InChIKey | PIIMHSRNKLWFLL-AWEZNQCLSA-N |
| XLogP | 0.97 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|