C18H34N2O2 — CID 174906027
2-methylprop-2-enoic acid;2,2,6,6-tetramethyl-4-piperidin-1-ylpiperidine (PubChem CID 174906027) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;2,2,6,6-tetramethyl-4-piperidin-1-ylpiperidine.
| Compound Name | 2-methylprop-2-enoic acid;2,2,6,6-tetramethyl-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 174906027 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | 2-methylprop-2-enoic acid;2,2,6,6-tetramethyl-4-piperidin-1-ylpiperidine |
| SMILES | C=C(C)C(=O)O.CC1(C)CC(N2CCCCC2)CC(C)(C)N1 |
| InChI | InChI=1S/C14H28N2.C4H6O2/c1-13(2)10-12(11-14(3,4)15-13)16-8-6-5-7-9-16;1-3(2)4(5)6/h12,15H,5-11H2,1-4H3;1H2,2H3,(H,5,6) |
| InChIKey | SGRXHKZBQTVZQY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|