C16H23N5O — CID 174908208
5-amino-N',4-dimethyl-N'-(2-methylpropyl)-1-phenylpyrazole-3-carbohydrazide (PubChem CID 174908208) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 5-amino-N',4-dimethyl-N'-(2-methylpropyl)-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | 5-amino-N',4-dimethyl-N'-(2-methylpropyl)-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 174908208 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 5-amino-N',4-dimethyl-N'-(2-methylpropyl)-1-phenylpyrazole-3-carbohydrazide |
| SMILES | Cc1c(C(=O)NN(C)CC(C)C)nn(-c2ccccc2)c1N |
| InChI | InChI=1S/C16H23N5O/c1-11(2)10-20(4)19-16(22)14-12(3)15(17)21(18-14)13-8-6-5-7-9-13/h5-9,11H,10,17H2,1-4H3,(H,19,22) |
| InChIKey | DDLPNHUPTKNRDL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|