C21H30O2 — CID 174909604
2-[(8S,9S,10R,13R,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-yl]acetic acid (PubChem CID 174909604) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13R,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-yl]acetic acid.
| Compound Name | 2-[(8S,9S,10R,13R,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-yl]acetic acid |
|---|---|
| PubChem CID | 174909604 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 2-[(8S,9S,10R,13R,14S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-yl]acetic acid |
| SMILES | C[C@@]12C=CC[C@H]1[C@@H]1CC=C3CCCC(CC(=O)O)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C21H30O2/c1-20-11-4-7-17(20)16-9-8-14-5-3-6-15(13-19(22)23)21(14,2)18(16)10-12-20/h4,8,11,15-18H,3,5-7,9-10,12-13H2,1-2H3,(H,22,23)/t15?,16-,17-,18-,20-,21+/m0/s1 |
| InChIKey | AMHJXICVYXOOCZ-SBGKXCIDSA-N |
| XLogP | 5.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|