C18H14N2O4S2 — CID 17491051
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(thiophene-2-carbonyl)thiophene-2-carbohydrazide (PubChem CID 17491051) has the molecular formula C18H14N2O4S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(thiophene-2-carbonyl)thiophene-2-carbohydrazide.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(thiophene-2-carbonyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 17491051 |
| Molecular Formula | C18H14N2O4S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(thiophene-2-carbonyl)thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(-c2ccc3c(c2)OCCO3)s1)c1cccs1 |
| InChI | InChI=1S/C18H14N2O4S2/c21-17(15-2-1-9-25-15)19-20-18(22)16-6-5-14(26-16)11-3-4-12-13(10-11)24-8-7-23-12/h1-6,9-10H,7-8H2,(H,19,21)(H,20,22) |
| InChIKey | CTULKTAWATUKCY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|