C23H19N3O4S — CID 31800795
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(1H-indol-3-yl)acetyl]thiophene-2-carbohydrazide (PubChem CID 31800795) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(1H-indol-3-yl)acetyl]thiophene-2-carbohydrazide.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(1H-indol-3-yl)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 31800795 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-[2-(1H-indol-3-yl)acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NNC(=O)c1ccc(-c2ccc3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C23H19N3O4S/c27-22(12-15-13-24-17-4-2-1-3-16(15)17)25-26-23(28)21-8-7-20(31-21)14-5-6-18-19(11-14)30-10-9-29-18/h1-8,11,13,24H,9-10,12H2,(H,25,27)(H,26,28) |
| InChIKey | XXVJXPXREDLRCX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|