C27H18F6N4O3 — CID 174911328
3-(trifluoromethyl)-4-[2,4,5-trifluoro-3-(2-morpholin-2-ylquinoxaline-6-carbonyl)phenyl]benzamide (PubChem CID 174911328) has the molecular formula C27H18F6N4O3 and a molecular weight of 560.45 g/mol. Its IUPAC name is 3-(trifluoromethyl)-4-[2,4,5-trifluoro-3-(2-morpholin-2-ylquinoxaline-6-carbonyl)phenyl]benzamide.
| Compound Name | 3-(trifluoromethyl)-4-[2,4,5-trifluoro-3-(2-morpholin-2-ylquinoxaline-6-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 174911328 |
| Molecular Formula | C27H18F6N4O3 |
| Molecular Weight | 560.45 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | 3-(trifluoromethyl)-4-[2,4,5-trifluoro-3-(2-morpholin-2-ylquinoxaline-6-carbonyl)phenyl]benzamide |
| SMILES | NC(=O)c1ccc(-c2cc(F)c(F)c(C(=O)c3ccc4nc(C5CNCCO5)cnc4c3)c2F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H18F6N4O3/c28-17-9-15(14-3-1-13(26(34)39)7-16(14)27(31,32)33)23(29)22(24(17)30)25(38)12-2-4-18-19(8-12)36-10-20(37-18)21-11-35-5-6-40-21/h1-4,7-10,21,35H,5-6,11H2,(H2,34,39) |
| InChIKey | POPLBKXZWJMVIJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|