C18H26N4O5 — CID 174911748
[4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamic acid;pyrrolidine-2,5-dione (PubChem CID 174911748) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is [4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamic acid;pyrrolidine-2,5-dione.
| Compound Name | [4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamic acid;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174911748 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [4-[2-(diethylamino)ethylcarbamoyl]phenyl]carbamic acid;pyrrolidine-2,5-dione |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)O)cc1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C14H21N3O3.C4H5NO2/c1-3-17(4-2)10-9-15-13(18)11-5-7-12(8-6-11)16-14(19)20;6-3-1-2-4(7)5-3/h5-8,16H,3-4,9-10H2,1-2H3,(H,15,18)(H,19,20);1-2H2,(H,5,6,7) |
| InChIKey | PMKDSSOPETYDHQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|