C34H68N2O — CID 174915443
N',N'-dimethyl-N-[1-(2-octylcyclopropyl)heptadecan-8-yl]butanehydrazide (PubChem CID 174915443) has the molecular formula C34H68N2O and a molecular weight of 520.93 g/mol. Its IUPAC name is N',N'-dimethyl-N-[1-(2-octylcyclopropyl)heptadecan-8-yl]butanehydrazide.
| Compound Name | N',N'-dimethyl-N-[1-(2-octylcyclopropyl)heptadecan-8-yl]butanehydrazide |
|---|---|
| PubChem CID | 174915443 |
| Molecular Formula | C34H68N2O |
| Molecular Weight | 520.93 g/mol |
| Exact Mass | 520.53 |
| IUPAC Name | N',N'-dimethyl-N-[1-(2-octylcyclopropyl)heptadecan-8-yl]butanehydrazide |
| SMILES | CCCCCCCCCC(CCCCCCCC1CC1CCCCCCCC)N(C(=O)CCC)N(C)C |
| InChI | InChI=1S/C34H68N2O/c1-6-9-11-13-15-19-23-28-33(36(35(4)5)34(37)25-8-3)29-24-20-16-18-22-27-32-30-31(32)26-21-17-14-12-10-7-2/h31-33H,6-30H2,1-5H3 |
| InChIKey | PQJCFTKNAUMLBJ-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.93 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|