About 2-methylpentanoyl 2,5-dimethylhexanoate
2-methylpentanoyl 2,5-dimethylhexanoate (PubChem CID 174916837) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-methylpentanoyl 2,5-dimethylhexanoate.
Molecular Properties
| Compound Name | 2-methylpentanoyl 2,5-dimethylhexanoate |
| PubChem CID | 174916837 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-methylpentanoyl 2,5-dimethylhexanoate |
| SMILES | CCCC(C)C(=O)OC(=O)C(C)CCC(C)C |
| InChI | InChI=1S/C14H26O3/c1-6-7-11(4)13(15)17-14(16)12(5)9-8-10(2)3/h10-12H,6-9H2,1-5H3 |
| InChIKey | IWSYLDRYVFXYAZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentanoyl 2,5-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentanoyl 2,5-dimethylhexanoate?
The IUPAC name of 2-methylpentanoyl 2,5-dimethylhexanoate (CID 174916837) is 2-methylpentanoyl 2,5-dimethylhexanoate.
What is the SMILES notation for 2-methylpentanoyl 2,5-dimethylhexanoate?
The canonical SMILES for 2-methylpentanoyl 2,5-dimethylhexanoate is CCCC(C)C(=O)OC(=O)C(C)CCC(C)C.
What is the InChIKey of 2-methylpentanoyl 2,5-dimethylhexanoate?
The InChIKey is IWSYLDRYVFXYAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-6-7-11(4)13(15)17-14(16)12(5)9-8-10(2)3/h10-12H,6-9H2,1-5H3.
What are the key properties of 2-methylpentanoyl 2,5-dimethylhexanoate?
2-methylpentanoyl 2,5-dimethylhexanoate has a molecular weight of 242.36 g/mol, XLogP of 3.56, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentanoyl 2,5-dimethylhexanoate is sourced from PubChem (CID 174916837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).