About pentan-1-amine;1,3-xylene
pentan-1-amine;1,3-xylene (PubChem CID 174917412) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is pentan-1-amine;1,3-xylene.
Molecular Properties
| Compound Name | pentan-1-amine;1,3-xylene |
| PubChem CID | 174917412 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | pentan-1-amine;1,3-xylene |
| SMILES | CCCCCN.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C5H13N/c1-7-4-3-5-8(2)6-7;1-2-3-4-5-6/h3-6H,1-2H3;2-6H2,1H3 |
| InChIKey | OXOPNWQKXODTHG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentan-1-amine;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-1-amine;1,3-xylene?
The IUPAC name of pentan-1-amine;1,3-xylene (CID 174917412) is pentan-1-amine;1,3-xylene.
What is the SMILES notation for pentan-1-amine;1,3-xylene?
The canonical SMILES for pentan-1-amine;1,3-xylene is CCCCCN.Cc1cccc(C)c1.
What is the InChIKey of pentan-1-amine;1,3-xylene?
The InChIKey is OXOPNWQKXODTHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C5H13N/c1-7-4-3-5-8(2)6-7;1-2-3-4-5-6/h3-6H,1-2H3;2-6H2,1H3.
What are the key properties of pentan-1-amine;1,3-xylene?
pentan-1-amine;1,3-xylene has a molecular weight of 193.33 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-1-amine;1,3-xylene is sourced from PubChem (CID 174917412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).