C20H22N2O5S — CID 174918377
3-[4-(1-amino-1-sulfinooxyethyl)phenyl]-7-propan-2-yl-1H-indole-2-carboxylic acid (PubChem CID 174918377) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is 3-[4-(1-amino-1-sulfinooxyethyl)phenyl]-7-propan-2-yl-1H-indole-2-carboxylic acid.
| Compound Name | 3-[4-(1-amino-1-sulfinooxyethyl)phenyl]-7-propan-2-yl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 174918377 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-[4-(1-amino-1-sulfinooxyethyl)phenyl]-7-propan-2-yl-1H-indole-2-carboxylic acid |
| SMILES | CC(C)c1cccc2c(-c3ccc(C(C)(N)OS(=O)O)cc3)c(C(=O)O)[nH]c12 |
| InChI | InChI=1S/C20H22N2O5S/c1-11(2)14-5-4-6-15-16(18(19(23)24)22-17(14)15)12-7-9-13(10-8-12)20(3,21)27-28(25)26/h4-11,22H,21H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | BUDGZSYLPDONFR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|