C22H26N2O4S — CID 129187457
ethyl 3-[4-(dimethylsulfamoyl)phenyl]-7-propan-2-yl-1H-indole-2-carboxylate (PubChem CID 129187457) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is ethyl 3-[4-(dimethylsulfamoyl)phenyl]-7-propan-2-yl-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[4-(dimethylsulfamoyl)phenyl]-7-propan-2-yl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 129187457 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | ethyl 3-[4-(dimethylsulfamoyl)phenyl]-7-propan-2-yl-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(C(C)C)cccc2c1-c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O4S/c1-6-28-22(25)21-19(18-9-7-8-17(14(2)3)20(18)23-21)15-10-12-16(13-11-15)29(26,27)24(4)5/h7-14,23H,6H2,1-5H3 |
| InChIKey | OJLBIQYTPRQLIN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |