C16H20N2O4S — CID 122389290
ethyl 3-methyl-5-[methyl(methylsulfonyl)amino]-4-phenyl-1H-pyrrole-2-carboxylate (PubChem CID 122389290) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is ethyl 3-methyl-5-[methyl(methylsulfonyl)amino]-4-phenyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[methyl(methylsulfonyl)amino]-4-phenyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 122389290 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | ethyl 3-methyl-5-[methyl(methylsulfonyl)amino]-4-phenyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(N(C)S(C)(=O)=O)c(-c2ccccc2)c1C |
| InChI | InChI=1S/C16H20N2O4S/c1-5-22-16(19)14-11(2)13(12-9-7-6-8-10-12)15(17-14)18(3)23(4,20)21/h6-10,17H,5H2,1-4H3 |
| InChIKey | OVINJFQVFSHVNQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |