C17H17NO2S — CID 129187506
3-(5-methylthiophen-2-yl)-7-propan-2-yl-1H-indole-2-carboxylic acid (PubChem CID 129187506) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-(5-methylthiophen-2-yl)-7-propan-2-yl-1H-indole-2-carboxylic acid.
| Compound Name | 3-(5-methylthiophen-2-yl)-7-propan-2-yl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 129187506 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-(5-methylthiophen-2-yl)-7-propan-2-yl-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccc(-c2c(C(=O)O)[nH]c3c(C(C)C)cccc23)s1 |
| InChI | InChI=1S/C17H17NO2S/c1-9(2)11-5-4-6-12-14(13-8-7-10(3)21-13)16(17(19)20)18-15(11)12/h4-9,18H,1-3H3,(H,19,20) |
| InChIKey | QIAPREYQDSQDAV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |