About potassium;2-aminobutanedioic acid;hexan-1-one
potassium;2-aminobutanedioic acid;hexan-1-one (PubChem CID 174919168) has the molecular formula C10H18KNO5
and a molecular weight of 271.35 g/mol. Its IUPAC name is potassium;2-aminobutanedioic acid;hexan-1-one.
Molecular Properties
| Compound Name | potassium;2-aminobutanedioic acid;hexan-1-one |
| PubChem CID | 174919168 |
| Molecular Formula | C10H18KNO5 |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | potassium;2-aminobutanedioic acid;hexan-1-one |
| SMILES | CCCCC[C-]=O.NC(CC(=O)O)C(=O)O.[K+] |
| InChI | InChI=1S/C6H11O.C4H7NO4.K/c1-2-3-4-5-6-7;5-2(4(8)9)1-3(6)7;/h2-5H2,1H3;2H,1,5H2,(H,6,7)(H,8,9);/q-1;;+1 |
| InChIKey | FHVDGYXQYKJHIH-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-aminobutanedioic acid;hexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-aminobutanedioic acid;hexan-1-one?
The IUPAC name of potassium;2-aminobutanedioic acid;hexan-1-one (CID 174919168) is potassium;2-aminobutanedioic acid;hexan-1-one.
What is the SMILES notation for potassium;2-aminobutanedioic acid;hexan-1-one?
The canonical SMILES for potassium;2-aminobutanedioic acid;hexan-1-one is CCCCC[C-]=O.NC(CC(=O)O)C(=O)O.[K+].
What is the InChIKey of potassium;2-aminobutanedioic acid;hexan-1-one?
The InChIKey is FHVDGYXQYKJHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O.C4H7NO4.K/c1-2-3-4-5-6-7;5-2(4(8)9)1-3(6)7;/h2-5H2,1H3;2H,1,5H2,(H,6,7)(H,8,9);/q-1;;+1.
What are the key properties of potassium;2-aminobutanedioic acid;hexan-1-one?
potassium;2-aminobutanedioic acid;hexan-1-one has a molecular weight of 271.35 g/mol, XLogP of -2.45, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-aminobutanedioic acid;hexan-1-one is sourced from PubChem (CID 174919168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).