C15H15N3O5S — CID 174921448
6-[(4-ethylsulfonylphenyl)methyl]-5-nitropyridine-3-carboxamide (PubChem CID 174921448) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is 6-[(4-ethylsulfonylphenyl)methyl]-5-nitropyridine-3-carboxamide.
| Compound Name | 6-[(4-ethylsulfonylphenyl)methyl]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 174921448 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 6-[(4-ethylsulfonylphenyl)methyl]-5-nitropyridine-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(Cc2ncc(C(N)=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H15N3O5S/c1-2-24(22,23)12-5-3-10(4-6-12)7-13-14(18(20)21)8-11(9-17-13)15(16)19/h3-6,8-9H,2,7H2,1H3,(H2,16,19) |
| InChIKey | KAQYKDSGDFEEPR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|