About (3,5-difluorophenyl) 2-methylidenebutanoate
(3,5-difluorophenyl) 2-methylidenebutanoate (PubChem CID 174922131) has the molecular formula C11H10F2O2
and a molecular weight of 212.19 g/mol. Its IUPAC name is (3,5-difluorophenyl) 2-methylidenebutanoate.
Molecular Properties
| Compound Name | (3,5-difluorophenyl) 2-methylidenebutanoate |
| PubChem CID | 174922131 |
| Molecular Formula | C11H10F2O2 |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (3,5-difluorophenyl) 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H10F2O2/c1-3-7(2)11(14)15-10-5-8(12)4-9(13)6-10/h4-6H,2-3H2,1H3 |
| InChIKey | DIPQAISOGJIQCT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,5-difluorophenyl) 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluorophenyl) 2-methylidenebutanoate?
The IUPAC name of (3,5-difluorophenyl) 2-methylidenebutanoate (CID 174922131) is (3,5-difluorophenyl) 2-methylidenebutanoate.
What is the SMILES notation for (3,5-difluorophenyl) 2-methylidenebutanoate?
The canonical SMILES for (3,5-difluorophenyl) 2-methylidenebutanoate is C=C(CC)C(=O)Oc1cc(F)cc(F)c1.
What is the InChIKey of (3,5-difluorophenyl) 2-methylidenebutanoate?
The InChIKey is DIPQAISOGJIQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2O2/c1-3-7(2)11(14)15-10-5-8(12)4-9(13)6-10/h4-6H,2-3H2,1H3.
What are the key properties of (3,5-difluorophenyl) 2-methylidenebutanoate?
(3,5-difluorophenyl) 2-methylidenebutanoate has a molecular weight of 212.19 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluorophenyl) 2-methylidenebutanoate is sourced from PubChem (CID 174922131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).