About 2-pentyl-1,4-thiazinane 1-oxide
2-pentyl-1,4-thiazinane 1-oxide (PubChem CID 174923223) has the molecular formula C9H19NOS
and a molecular weight of 189.32 g/mol. Its IUPAC name is 2-pentyl-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | 2-pentyl-1,4-thiazinane 1-oxide |
| PubChem CID | 174923223 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-pentyl-1,4-thiazinane 1-oxide |
| SMILES | CCCCCC1CNCCS1=O |
| InChI | InChI=1S/C9H19NOS/c1-2-3-4-5-9-8-10-6-7-12(9)11/h9-10H,2-8H2,1H3 |
| InChIKey | SAPJERYBZFCUAT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-1,4-thiazinane 1-oxide?
The IUPAC name of 2-pentyl-1,4-thiazinane 1-oxide (CID 174923223) is 2-pentyl-1,4-thiazinane 1-oxide.
What is the SMILES notation for 2-pentyl-1,4-thiazinane 1-oxide?
The canonical SMILES for 2-pentyl-1,4-thiazinane 1-oxide is CCCCCC1CNCCS1=O.
What is the InChIKey of 2-pentyl-1,4-thiazinane 1-oxide?
The InChIKey is SAPJERYBZFCUAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NOS/c1-2-3-4-5-9-8-10-6-7-12(9)11/h9-10H,2-8H2,1H3.
What are the key properties of 2-pentyl-1,4-thiazinane 1-oxide?
2-pentyl-1,4-thiazinane 1-oxide has a molecular weight of 189.32 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-1,4-thiazinane 1-oxide is sourced from PubChem (CID 174923223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).