About (1S)-5-pentyldithiolane 1-oxide
(1S)-5-pentyldithiolane 1-oxide (PubChem CID 57284800) has the molecular formula C8H16OS2
and a molecular weight of 192.35 g/mol. Its IUPAC name is (1S)-5-pentyldithiolane 1-oxide.
Molecular Properties
| Compound Name | (1S)-5-pentyldithiolane 1-oxide |
| PubChem CID | 57284800 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (1S)-5-pentyldithiolane 1-oxide |
| SMILES | CCCCCC1CCS[S@@]1=O |
| InChI | InChI=1S/C8H16OS2/c1-2-3-4-5-8-6-7-10-11(8)9/h8H,2-7H2,1H3/t8?,11-/m0/s1 |
| InChIKey | JVMYEFUSCUKEKI-LYNSQETBSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze (1S)-5-pentyldithiolane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-5-pentyldithiolane 1-oxide?
The IUPAC name of (1S)-5-pentyldithiolane 1-oxide (CID 57284800) is (1S)-5-pentyldithiolane 1-oxide.
What is the SMILES notation for (1S)-5-pentyldithiolane 1-oxide?
The canonical SMILES for (1S)-5-pentyldithiolane 1-oxide is CCCCCC1CCS[S@@]1=O.
What is the InChIKey of (1S)-5-pentyldithiolane 1-oxide?
The InChIKey is JVMYEFUSCUKEKI-LYNSQETBSA-N. The full InChI is InChI=1S/C8H16OS2/c1-2-3-4-5-8-6-7-10-11(8)9/h8H,2-7H2,1H3/t8?,11-/m0/s1.
What are the key properties of (1S)-5-pentyldithiolane 1-oxide?
(1S)-5-pentyldithiolane 1-oxide has a molecular weight of 192.35 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-5-pentyldithiolane 1-oxide is sourced from PubChem (CID 57284800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).