C11H22OS2 — CID 135080437
(1S,2R)-2-heptyl-1,3-dithiane 1-oxide (PubChem CID 135080437) has the molecular formula C11H22OS2 and a molecular weight of 234.43 g/mol. Its IUPAC name is (1S,2R)-2-heptyl-1,3-dithiane 1-oxide.
| Compound Name | (1S,2R)-2-heptyl-1,3-dithiane 1-oxide |
|---|---|
| PubChem CID | 135080437 |
| Molecular Formula | C11H22OS2 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (1S,2R)-2-heptyl-1,3-dithiane 1-oxide |
| SMILES | CCCCCCC[C@@H]1SCCC[S@@]1=O |
| InChI | InChI=1S/C11H22OS2/c1-2-3-4-5-6-8-11-13-9-7-10-14(11)12/h11H,2-10H2,1H3/t11-,14+/m1/s1 |
| InChIKey | WQWXDAAXIOBBMS-RISCZKNCSA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|