C12H8Br2Cl2O4 — CID 174923260
2,3-dibromobenzene-1,4-diol;2,3-dichlorobenzene-1,4-diol (PubChem CID 174923260) has the molecular formula C12H8Br2Cl2O4 and a molecular weight of 446.91 g/mol. Its IUPAC name is 2,3-dibromobenzene-1,4-diol;2,3-dichlorobenzene-1,4-diol.
| Compound Name | 2,3-dibromobenzene-1,4-diol;2,3-dichlorobenzene-1,4-diol |
|---|---|
| PubChem CID | 174923260 |
| Molecular Formula | C12H8Br2Cl2O4 |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 443.82 |
| IUPAC Name | 2,3-dibromobenzene-1,4-diol;2,3-dichlorobenzene-1,4-diol |
| SMILES | Oc1ccc(O)c(Br)c1Br.Oc1ccc(O)c(Cl)c1Cl |
| InChI | InChI=1S/C6H4Br2O2.C6H4Cl2O2/c2*7-5-3(9)1-2-4(10)6(5)8/h2*1-2,9-10H |
| InChIKey | JUKNNXKRNHHUGV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|