C8H13F3N2O3 — CID 174924702
[4-(methylamino)pentanoylamino] 2,2,2-trifluoroacetate (PubChem CID 174924702) has the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. Its IUPAC name is [4-(methylamino)pentanoylamino] 2,2,2-trifluoroacetate.
| Compound Name | [4-(methylamino)pentanoylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174924702 |
| Molecular Formula | C8H13F3N2O3 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [4-(methylamino)pentanoylamino] 2,2,2-trifluoroacetate |
| SMILES | CNC(C)CCC(=O)NOC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O3/c1-5(12-2)3-4-6(14)13-16-7(15)8(9,10)11/h5,12H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | RDDPNQDXHGAOMM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|