C19H20N6OS2 — CID 17492513
N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide (PubChem CID 17492513) has the molecular formula C19H20N6OS2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide.
| Compound Name | N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide |
|---|---|
| PubChem CID | 17492513 |
| Molecular Formula | C19H20N6OS2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanamide |
| SMILES | Cc1cc(-c2csc(NC(=O)CCc3c(C)nc4ncnn4c3C)n2)c(C)s1 |
| InChI | InChI=1S/C19H20N6OS2/c1-10-7-15(13(4)28-10)16-8-27-19(23-16)24-17(26)6-5-14-11(2)22-18-20-9-21-25(18)12(14)3/h7-9H,5-6H2,1-4H3,(H,23,24,26) |
| InChIKey | SZXVCGCSIYNTJH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |