C21H22N6OS — CID 8819591
2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 8819591) has the molecular formula C21H22N6OS and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 8819591 |
| Molecular Formula | C21H22N6OS |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)Cc3c(C)nc4ncnn4c3C)n2)cc1C |
| InChI | InChI=1S/C21H22N6OS/c1-11-6-13(3)16(7-12(11)2)18-9-29-21(25-18)26-19(28)8-17-14(4)24-20-22-10-23-27(20)15(17)5/h6-7,9-10H,8H2,1-5H3,(H,25,26,28) |
| InChIKey | IZKIAYHYYQYMLL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |