C22H24N6OS — CID 9142256
3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 9142256) has the molecular formula C22H24N6OS and a molecular weight of 420.54 g/mol. Its IUPAC name is 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 9142256 |
| Molecular Formula | C22H24N6OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)CCc3c(C)nc4ncnn4c3C)n2)cc1C |
| InChI | InChI=1S/C22H24N6OS/c1-12-8-14(3)18(9-13(12)2)19-10-30-22(26-19)27-20(29)7-6-17-15(4)25-21-23-11-24-28(21)16(17)5/h8-11H,6-7H2,1-5H3,(H,26,27,29) |
| InChIKey | PARBACKNICJUTK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |