About ethoxycarbonyl 11-aminoundecanoate;hydrochloride
ethoxycarbonyl 11-aminoundecanoate;hydrochloride (PubChem CID 174925199) has the molecular formula C14H28ClNO4
and a molecular weight of 309.83 g/mol. Its IUPAC name is ethoxycarbonyl 11-aminoundecanoate;hydrochloride.
Molecular Properties
| Compound Name | ethoxycarbonyl 11-aminoundecanoate;hydrochloride |
| PubChem CID | 174925199 |
| Molecular Formula | C14H28ClNO4 |
| Molecular Weight | 309.83 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethoxycarbonyl 11-aminoundecanoate;hydrochloride |
| SMILES | CCOC(=O)OC(=O)CCCCCCCCCCN.Cl |
| InChI | InChI=1S/C14H27NO4.ClH/c1-2-18-14(17)19-13(16)11-9-7-5-3-4-6-8-10-12-15;/h2-12,15H2,1H3;1H |
| InChIKey | RBTXOAMQXBVIBS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethoxycarbonyl 11-aminoundecanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxycarbonyl 11-aminoundecanoate;hydrochloride?
The IUPAC name of ethoxycarbonyl 11-aminoundecanoate;hydrochloride (CID 174925199) is ethoxycarbonyl 11-aminoundecanoate;hydrochloride.
What is the SMILES notation for ethoxycarbonyl 11-aminoundecanoate;hydrochloride?
The canonical SMILES for ethoxycarbonyl 11-aminoundecanoate;hydrochloride is CCOC(=O)OC(=O)CCCCCCCCCCN.Cl.
What is the InChIKey of ethoxycarbonyl 11-aminoundecanoate;hydrochloride?
The InChIKey is RBTXOAMQXBVIBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO4.ClH/c1-2-18-14(17)19-13(16)11-9-7-5-3-4-6-8-10-12-15;/h2-12,15H2,1H3;1H.
What are the key properties of ethoxycarbonyl 11-aminoundecanoate;hydrochloride?
ethoxycarbonyl 11-aminoundecanoate;hydrochloride has a molecular weight of 309.83 g/mol, XLogP of 3.58, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxycarbonyl 11-aminoundecanoate;hydrochloride is sourced from PubChem (CID 174925199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).