About 2-phenylethylcarbamoyl phenylmethanesulfonate
2-phenylethylcarbamoyl phenylmethanesulfonate (PubChem CID 174927101) has the molecular formula C16H17NO4S
and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-phenylethylcarbamoyl phenylmethanesulfonate.
Molecular Properties
| Compound Name | 2-phenylethylcarbamoyl phenylmethanesulfonate |
| PubChem CID | 174927101 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-phenylethylcarbamoyl phenylmethanesulfonate |
| SMILES | O=C(NCCc1ccccc1)OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO4S/c18-16(17-12-11-14-7-3-1-4-8-14)21-22(19,20)13-15-9-5-2-6-10-15/h1-10H,11-13H2,(H,17,18) |
| InChIKey | ZFKGTKZMBTUGOE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethylcarbamoyl phenylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethylcarbamoyl phenylmethanesulfonate?
The IUPAC name of 2-phenylethylcarbamoyl phenylmethanesulfonate (CID 174927101) is 2-phenylethylcarbamoyl phenylmethanesulfonate.
What is the SMILES notation for 2-phenylethylcarbamoyl phenylmethanesulfonate?
The canonical SMILES for 2-phenylethylcarbamoyl phenylmethanesulfonate is O=C(NCCc1ccccc1)OS(=O)(=O)Cc1ccccc1.
What is the InChIKey of 2-phenylethylcarbamoyl phenylmethanesulfonate?
The InChIKey is ZFKGTKZMBTUGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4S/c18-16(17-12-11-14-7-3-1-4-8-14)21-22(19,20)13-15-9-5-2-6-10-15/h1-10H,11-13H2,(H,17,18).
What are the key properties of 2-phenylethylcarbamoyl phenylmethanesulfonate?
2-phenylethylcarbamoyl phenylmethanesulfonate has a molecular weight of 319.38 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethylcarbamoyl phenylmethanesulfonate is sourced from PubChem (CID 174927101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).