About azane;(tert-butylamino) 2,2-dimethylpropanoate
azane;(tert-butylamino) 2,2-dimethylpropanoate (PubChem CID 174934369) has the molecular formula C9H22N2O2
and a molecular weight of 190.29 g/mol. Its IUPAC name is azane;(tert-butylamino) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | azane;(tert-butylamino) 2,2-dimethylpropanoate |
| PubChem CID | 174934369 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | azane;(tert-butylamino) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)NOC(=O)C(C)(C)C.N |
| InChI | InChI=1S/C9H19NO2.H3N/c1-8(2,3)7(11)12-10-9(4,5)6;/h10H,1-6H3;1H3 |
| InChIKey | IXKRDOXISZBGMJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;(tert-butylamino) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(tert-butylamino) 2,2-dimethylpropanoate?
The IUPAC name of azane;(tert-butylamino) 2,2-dimethylpropanoate (CID 174934369) is azane;(tert-butylamino) 2,2-dimethylpropanoate.
What is the SMILES notation for azane;(tert-butylamino) 2,2-dimethylpropanoate?
The canonical SMILES for azane;(tert-butylamino) 2,2-dimethylpropanoate is CC(C)(C)NOC(=O)C(C)(C)C.N.
What is the InChIKey of azane;(tert-butylamino) 2,2-dimethylpropanoate?
The InChIKey is IXKRDOXISZBGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2.H3N/c1-8(2,3)7(11)12-10-9(4,5)6;/h10H,1-6H3;1H3.
What are the key properties of azane;(tert-butylamino) 2,2-dimethylpropanoate?
azane;(tert-butylamino) 2,2-dimethylpropanoate has a molecular weight of 190.29 g/mol, XLogP of 2.04, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(tert-butylamino) 2,2-dimethylpropanoate is sourced from PubChem (CID 174934369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).