2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid

C16H10Cl4O2 — CID 174934692

IUPAC2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid
SMILESO=C(O)C1CC1(c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C16H10Cl4O2/c17-11-3-1-8(5-13(11)19)16(7-10(16)15(21)22)9-2-4-12(18)14(20)6-9/h1-6,10H,7H2,(H,21,22)
InChIKeyRIURPVGHPCFFHD-UHFFFAOYSA-N
MW376.07 g/mol
LogP5.69
Rot. Bonds3

About 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid

2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid (PubChem CID 174934692) has the molecular formula C16H10Cl4O2 and a molecular weight of 376.07 g/mol. Its IUPAC name is 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid
PubChem CID174934692
Molecular FormulaC16H10Cl4O2
Molecular Weight376.07 g/mol
Exact Mass373.94
IUPAC Name2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid
SMILESO=C(O)C1CC1(c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C16H10Cl4O2/c17-11-3-1-8(5-13(11)19)16(7-10(16)15(21)22)9-2-4-12(18)14(20)6-9/h1-6,10H,7H2,(H,21,22)
InChIKeyRIURPVGHPCFFHD-UHFFFAOYSA-N
XLogP5.69
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500376.07
LogP ≤ 55.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid?
The IUPAC name of 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid (CID 174934692) is 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid is O=C(O)C1CC1(c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid?
The InChIKey is RIURPVGHPCFFHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl4O2/c17-11-3-1-8(5-13(11)19)16(7-10(16)15(21)22)9-2-4-12(18)14(20)6-9/h1-6,10H,7H2,(H,21,22).
What are the key properties of 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid?
2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid has a molecular weight of 376.07 g/mol, XLogP of 5.69, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 174934692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).