C11H9Cl2NO — CID 164674723
(1S,5R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 164674723) has the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. Its IUPAC name is (1S,5R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 164674723 |
| Molecular Formula | C11H9Cl2NO |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | (1S,5R)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1NC[C@@H]2C[C@]12c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2NO/c12-8-2-1-6(3-9(8)13)11-4-7(11)5-14-10(11)15/h1-3,7H,4-5H2,(H,14,15)/t7-,11+/m0/s1 |
| InChIKey | VESNYTDSJWGARF-WRWORJQWSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |