C16H17Cl2NO2 — CID 143403313
1-(3,4-dichlorophenyl)-3-(2-methylbutan-2-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 143403313) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2-methylbutan-2-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2-methylbutan-2-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 143403313 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2-methylbutan-2-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CCC(C)(C)N1C(=O)C2CC2(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C16H17Cl2NO2/c1-4-15(2,3)19-13(20)10-8-16(10,14(19)21)9-5-6-11(17)12(18)7-9/h5-7,10H,4,8H2,1-3H3 |
| InChIKey | KMGBJMQOWZQHER-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|