C17H25Cl2N — CID 159699770
1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hexane (PubChem CID 159699770) has the molecular formula C17H25Cl2N and a molecular weight of 314.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hexane.
| Compound Name | 1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hexane |
|---|---|
| PubChem CID | 159699770 |
| Molecular Formula | C17H25Cl2N |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hexane |
| SMILES | CCCCCC.Clc1ccc(C23CNCC2C3)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N.C6H14/c12-9-2-1-7(3-10(9)13)11-4-8(11)5-14-6-11;1-3-5-6-4-2/h1-3,8,14H,4-6H2;3-6H2,1-2H3 |
| InChIKey | MXLVYJZPNKJIPE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|