C12H13Cl2N — CID 24849583
(1R,6S)-1-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptane (PubChem CID 24849583) has the molecular formula C12H13Cl2N and a molecular weight of 242.15 g/mol. Its IUPAC name is (1R,6S)-1-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptane.
| Compound Name | (1R,6S)-1-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 24849583 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | (1R,6S)-1-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptane |
| SMILES | Clc1ccc([C@]23CNCC[C@@H]2C3)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N/c13-10-2-1-8(5-11(10)14)12-6-9(12)3-4-15-7-12/h1-2,5,9,15H,3-4,6-7H2/t9-,12+/m1/s1 |
| InChIKey | IWEJGKHITDGZSV-SKDRFNHKSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |