C11H11Cl2NO — CID 143618079
(5R)-5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-ol (PubChem CID 143618079) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is (5R)-5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-ol.
| Compound Name | (5R)-5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 143618079 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | (5R)-5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-2-ol |
| SMILES | OC1NC[C@]2(c3ccc(Cl)c(Cl)c3)CC12 |
| InChI | InChI=1S/C11H11Cl2NO/c12-8-2-1-6(3-9(8)13)11-4-7(11)10(15)14-5-11/h1-3,7,10,14-15H,4-5H2/t7?,10?,11-/m0/s1 |
| InChIKey | CFHOMYMQNMGREW-KKOQCAIRSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |