C11H9Cl2NOS — CID 169149806
1-(3,4-dichlorophenyl)-2-thia-5-azabicyclo[2.2.1]heptan-3-one (PubChem CID 169149806) has the molecular formula C11H9Cl2NOS and a molecular weight of 274.17 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-thia-5-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | 1-(3,4-dichlorophenyl)-2-thia-5-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 169149806 |
| Molecular Formula | C11H9Cl2NOS |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-thia-5-azabicyclo[2.2.1]heptan-3-one |
| SMILES | O=C1SC2(c3ccc(Cl)c(Cl)c3)CNC1C2 |
| InChI | InChI=1S/C11H9Cl2NOS/c12-7-2-1-6(3-8(7)13)11-4-9(14-5-11)10(15)16-11/h1-3,9,14H,4-5H2 |
| InChIKey | VNSKDEYTCOPYLT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|