C11H10Cl2N2O — CID 141143893
4-(3,4-dichlorophenyl)-4-methyl-1,5-dihydropyrimidin-6-one (PubChem CID 141143893) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-4-methyl-1,5-dihydropyrimidin-6-one.
| Compound Name | 4-(3,4-dichlorophenyl)-4-methyl-1,5-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 141143893 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-4-methyl-1,5-dihydropyrimidin-6-one |
| SMILES | CC1(c2ccc(Cl)c(Cl)c2)CC(=O)NC=N1 |
| InChI | InChI=1S/C11H10Cl2N2O/c1-11(5-10(16)14-6-15-11)7-2-3-8(12)9(13)4-7/h2-4,6H,5H2,1H3,(H,14,15,16) |
| InChIKey | CIXKTQOZDKAETB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |