C14H13Cl2NO2 — CID 24757182
(3S)-3-(3,4-dichlorophenyl)-3-prop-2-enylpiperidine-2,6-dione (PubChem CID 24757182) has the molecular formula C14H13Cl2NO2 and a molecular weight of 298.17 g/mol. Its IUPAC name is (3S)-3-(3,4-dichlorophenyl)-3-prop-2-enylpiperidine-2,6-dione.
| Compound Name | (3S)-3-(3,4-dichlorophenyl)-3-prop-2-enylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 24757182 |
| Molecular Formula | C14H13Cl2NO2 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | (3S)-3-(3,4-dichlorophenyl)-3-prop-2-enylpiperidine-2,6-dione |
| SMILES | C=CC[C@]1(c2ccc(Cl)c(Cl)c2)CCC(=O)NC1=O |
| InChI | InChI=1S/C14H13Cl2NO2/c1-2-6-14(7-5-12(18)17-13(14)19)9-3-4-10(15)11(16)8-9/h2-4,8H,1,5-7H2,(H,17,18,19)/t14-/m1/s1 |
| InChIKey | METILZFJUKAYDS-CQSZACIVSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|