C14H13Cl2NO4 — CID 11088812
3-[(3S)-3-(3,4-dichlorophenyl)-2,6-dioxopiperidin-3-yl]propanoic acid (PubChem CID 11088812) has the molecular formula C14H13Cl2NO4 and a molecular weight of 330.17 g/mol. Its IUPAC name is 3-[(3S)-3-(3,4-dichlorophenyl)-2,6-dioxopiperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S)-3-(3,4-dichlorophenyl)-2,6-dioxopiperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 11088812 |
| Molecular Formula | C14H13Cl2NO4 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 3-[(3S)-3-(3,4-dichlorophenyl)-2,6-dioxopiperidin-3-yl]propanoic acid |
| SMILES | O=C(O)CC[C@]1(c2ccc(Cl)c(Cl)c2)CCC(=O)NC1=O |
| InChI | InChI=1S/C14H13Cl2NO4/c15-9-2-1-8(7-10(9)16)14(6-4-12(19)20)5-3-11(18)17-13(14)21/h1-2,7H,3-6H2,(H,19,20)(H,17,18,21)/t14-/m0/s1 |
| InChIKey | HXMKDQGJBDSOIM-AWEZNQCLSA-N |
| XLogP | 2.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|