C24H29N3O6 — CID 10004157
ethyl 6-[3-[3-(butylamino)-3-oxopropyl]-2,6-dioxopiperidin-3-yl]-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 10004157) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is ethyl 6-[3-[3-(butylamino)-3-oxopropyl]-2,6-dioxopiperidin-3-yl]-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 6-[3-[3-(butylamino)-3-oxopropyl]-2,6-dioxopiperidin-3-yl]-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 10004157 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | ethyl 6-[3-[3-(butylamino)-3-oxopropyl]-2,6-dioxopiperidin-3-yl]-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | CCCCNC(=O)CCC1(c2ccc3[nH]cc(C(=O)OCC)c(=O)c3c2)CCC(=O)NC1=O |
| InChI | InChI=1S/C24H29N3O6/c1-3-5-12-25-19(28)8-10-24(11-9-20(29)27-23(24)32)15-6-7-18-16(13-15)21(30)17(14-26-18)22(31)33-4-2/h6-7,13-14H,3-5,8-12H2,1-2H3,(H,25,28)(H,26,30)(H,27,29,32) |
| InChIKey | YEKXMZOODRJMBW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|